Compound Q&A

What precautions should be taken when handling 2,5-Dibromoterephthalaldehyde (CAS: 63525-48-4)?

Answer

2,5-Dibromoterephthalaldehyde
When handling 2,5-Dibromoterephthalaldehyde (CAS: 63525-48-4), it is essential to use proper Personal Protective Equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be stored in a cool, dry place, away from direct sunlight and heat sources. Fume hoods should be used during the handling and synthesis of this compound to minimize exposure to bromine vapor. In case of a spill, it should be cleaned up immediately using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for further handling and disposal instructions.

About

CAS No 63525-48-4
English Name 2,5-Dibromoterephthalaldehyde
Molecular Formula C8H4Br2O2
Molecular Weight 291.93 g/mol
SMILES BrC1=CC(C=O)=C(Br)C=C1C=O
InChIKey VSUKSWCSOBXUFG-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,5-Dibromoterephthalaldehyde (CAS: 63525-48-4)?

2,5-Dibromoterephthalaldehyde (CAS: 63525-48-4) is a crystalline compound with a molecular weight of...

Compound Q&A

How is 2,5-Dibromoterephthalaldehyde (CAS: 63525-48-4) typically synthesized?

2,5-Dibromoterephthalaldehyde is typically synthesized via the bromination of terephthalaldehyde. Th...

Compound Q&A

What industries use 2,5-Dibromoterephthalaldehyde (CAS: 63525-48-4)?

2,5-Dibromoterephthalaldehyde (CAS: 63525-48-4) is primarily used in the pharmaceutical industry for...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...