Compound Q&A

What industries use 2,5-Dibromoterephthalaldehyde (CAS: 63525-48-4)?

Answer

2,5-Dibromoterephthalaldehyde
2,5-Dibromoterephthalaldehyde (CAS: 63525-48-4) is primarily used in the pharmaceutical industry for the synthesis of certain organic compounds. It also finds applications in the polymer industry, where it is used as a monomer for the production of special polymers. Additionally, it is utilized in the sensor industry for the development of chemical sensors and in the semiconductor industry for manufacturing processes involving organic materials.

About

CAS No 63525-48-4
English Name 2,5-Dibromoterephthalaldehyde
Molecular Formula C8H4Br2O2
Molecular Weight 291.93 g/mol
SMILES BrC1=CC(C=O)=C(Br)C=C1C=O
InChIKey VSUKSWCSOBXUFG-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,5-Dibromoterephthalaldehyde (CAS: 63525-48-4)?

2,5-Dibromoterephthalaldehyde (CAS: 63525-48-4) is a crystalline compound with a molecular weight of...

Compound Q&A

How is 2,5-Dibromoterephthalaldehyde (CAS: 63525-48-4) typically synthesized?

2,5-Dibromoterephthalaldehyde is typically synthesized via the bromination of terephthalaldehyde. Th...

Compound Q&A

What precautions should be taken when handling 2,5-Dibromoterephthalaldehyde (CAS: 63525-48-4)?

When handling 2,5-Dibromoterephthalaldehyde (CAS: 63525-48-4), it is essential to use proper Persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...