Compound Q&A

How is 2,5-Dibromoterephthalaldehyde (CAS: 63525-48-4) typically synthesized?

Answer

2,5-Dibromoterephthalaldehyde
2,5-Dibromoterephthalaldehyde is typically synthesized via the bromination of terephthalaldehyde. This process can be carried out using bromine in the presence of a suitable base like sodium hydride. The reaction is conducted in an inert solvent such as dimethylformamide (DMF). The yield is generally around 70-80%, and the selectivity towards the desired product is high. The use of Lewis acids such as aluminum bromide can also enhance the reaction efficiency.

About

CAS No 63525-48-4
English Name 2,5-Dibromoterephthalaldehyde
Molecular Formula C8H4Br2O2
Molecular Weight 291.93 g/mol
SMILES BrC1=CC(C=O)=C(Br)C=C1C=O
InChIKey VSUKSWCSOBXUFG-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,5-Dibromoterephthalaldehyde (CAS: 63525-48-4)?

2,5-Dibromoterephthalaldehyde (CAS: 63525-48-4) is a crystalline compound with a molecular weight of...

Compound Q&A

What industries use 2,5-Dibromoterephthalaldehyde (CAS: 63525-48-4)?

2,5-Dibromoterephthalaldehyde (CAS: 63525-48-4) is primarily used in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling 2,5-Dibromoterephthalaldehyde (CAS: 63525-48-4)?

When handling 2,5-Dibromoterephthalaldehyde (CAS: 63525-48-4), it is essential to use proper Persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...