Compound Q&A

What precautions should be taken when handling Propylsilanetriyl triacetate (CAS: 17865-07-5)?

Answer

Propylsilanetriyl triacetate
When handling Propylsilanetriyl triacetate (CAS: 17865-07-5), appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn to prevent skin and eye contact. Work should be conducted in a well-ventilated area or a fume hood to avoid inhalation. Spills should be cleaned up immediately using appropriate absorbent materials, and the area should be thoroughly washed. Always refer to the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

CAS No 17865-07-5
English Name Propylsilanetriyl triacetate
Molecular Formula C9H16O6Si
Molecular Weight 248.31 g/mol
SMILES CCC[Si](OC(=O)C)(OC(=O)C)OC(=O)C
InChIKey DKGZKEKMWBGTIB-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Propylsilanetriyl triacetate (CAS: 17865-07-5)?

Propylsilanetriyl triacetate (CAS: 17865-07-5) is a colorless liquid with a molecular weight of appr...

Compound Q&A

How is Propylsilanetriyl triacetate (CAS: 17865-07-5) typically synthesized?

Propylsilanetriyl triacetate (CAS: 17865-07-5) is typically synthesized through the reaction of prop...

Compound Q&A

What industries use Propylsilanetriyl triacetate (CAS: 17865-07-5)?

Propylsilanetriyl triacetate (CAS: 17865-07-5) is utilized in various industries, including pharmace...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...