Compound Q&A

What industries use Propylsilanetriyl triacetate (CAS: 17865-07-5)?

Answer

Propylsilanetriyl triacetate
Propylsilanetriyl triacetate (CAS: 17865-07-5) is utilized in various industries, including pharmaceuticals for coating and derivatization of drugs, polymers for modifying and enhancing properties, sensors for improving sensitivity and stability, and semiconductors for etching and cleaning processes. It is also used in the formulation of adhesives and coatings due to its reactive functionality.

About

CAS No 17865-07-5
English Name Propylsilanetriyl triacetate
Molecular Formula C9H16O6Si
Molecular Weight 248.31 g/mol
SMILES CCC[Si](OC(=O)C)(OC(=O)C)OC(=O)C
InChIKey DKGZKEKMWBGTIB-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Propylsilanetriyl triacetate (CAS: 17865-07-5)?

Propylsilanetriyl triacetate (CAS: 17865-07-5) is a colorless liquid with a molecular weight of appr...

Compound Q&A

How is Propylsilanetriyl triacetate (CAS: 17865-07-5) typically synthesized?

Propylsilanetriyl triacetate (CAS: 17865-07-5) is typically synthesized through the reaction of prop...

Compound Q&A

What precautions should be taken when handling Propylsilanetriyl triacetate (CAS: 17865-07-5)?

When handling Propylsilanetriyl triacetate (CAS: 17865-07-5), appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...