Compound Q&A

What are the physical and chemical properties of Propylsilanetriyl triacetate (CAS: 17865-07-5)?

Answer

Propylsilanetriyl triacetate
Propylsilanetriyl triacetate (CAS: 17865-07-5) is a colorless liquid with a molecular weight of approximately 248.4 g/mol. It has a low boiling point and is poorly soluble in water but miscible with organic solvents. The compound is reactive towards hydroxyl groups and can undergo hydrolysis under basic conditions. It forms crystals under certain conditions, making it suitable for applications requiring stability in various environments.

About

CAS No 17865-07-5
English Name Propylsilanetriyl triacetate
Molecular Formula C9H16O6Si
Molecular Weight 248.31 g/mol
SMILES CCC[Si](OC(=O)C)(OC(=O)C)OC(=O)C
InChIKey DKGZKEKMWBGTIB-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is Propylsilanetriyl triacetate (CAS: 17865-07-5) typically synthesized?

Propylsilanetriyl triacetate (CAS: 17865-07-5) is typically synthesized through the reaction of prop...

Compound Q&A

What industries use Propylsilanetriyl triacetate (CAS: 17865-07-5)?

Propylsilanetriyl triacetate (CAS: 17865-07-5) is utilized in various industries, including pharmace...

Compound Q&A

What precautions should be taken when handling Propylsilanetriyl triacetate (CAS: 17865-07-5)?

When handling Propylsilanetriyl triacetate (CAS: 17865-07-5), appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...