Compound Q&A

How is Propylsilanetriyl triacetate (CAS: 17865-07-5) typically synthesized?

Answer

Propylsilanetriyl triacetate
Propylsilanetriyl triacetate (CAS: 17865-07-5) is typically synthesized through the reaction of propylsilane with acetic anhydride in the presence of a catalytic amount of a Lewis acid, such as aluminum chloride. The process involves acetylation of the propylsilane to form the desired triacetate, with high selectivity and yield. The exact conditions may vary depending on the scale of production and desired purity.

About

CAS No 17865-07-5
English Name Propylsilanetriyl triacetate
Molecular Formula C9H16O6Si
Molecular Weight 248.31 g/mol
SMILES CCC[Si](OC(=O)C)(OC(=O)C)OC(=O)C
InChIKey DKGZKEKMWBGTIB-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Propylsilanetriyl triacetate (CAS: 17865-07-5)?

Propylsilanetriyl triacetate (CAS: 17865-07-5) is a colorless liquid with a molecular weight of appr...

Compound Q&A

What industries use Propylsilanetriyl triacetate (CAS: 17865-07-5)?

Propylsilanetriyl triacetate (CAS: 17865-07-5) is utilized in various industries, including pharmace...

Compound Q&A

What precautions should be taken when handling Propylsilanetriyl triacetate (CAS: 17865-07-5)?

When handling Propylsilanetriyl triacetate (CAS: 17865-07-5), appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...