Compound Q&A

What precautions should be taken when handling Pentafluoropropanoic anhydride (CAS: 356-42-3)?

Answer

Pentafluoropropanoic anhydride
When handling Pentafluoropropanoic anhydride (CAS: 356-42-3), it is essential to use appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Ensure that all operations are conducted in a well-ventilated environment or a fume hood to minimize inhalation. Spills should be cleaned up immediately using appropriate absorbents and disposed of according to local regulations. Refer to the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

CAS No 356-42-3
English Name Pentafluoropropanoic anhydride
Molecular Formula C6F10O3
Molecular Weight 310.04 g/mol
SMILES C(=O)(C(C(F)(F)F)(F)F)OC(=O)C(C(F)(F)F)(F)F
InChIKey XETRHNFRKCNWAJ-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pentafluoropropanoic anhydride (CAS: 356-42-3)?

Pentafluoropropanoic anhydride (CAS: 356-42-3) is a colorless liquid with a high molecular weight an...

Compound Q&A

How is Pentafluoropropanoic anhydride (CAS: 356-42-3) typically synthesized?

Pentafluoropropanoic anhydride is typically synthesized through the condensation of pentafluoropropa...

Compound Q&A

What industries use Pentafluoropropanoic anhydride (CAS: 356-42-3)?

Pentafluoropropanoic anhydride (CAS: 356-42-3) is used in the pharmaceutical industry for the synthe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...