Compound Q&A

How is Pentafluoropropanoic anhydride (CAS: 356-42-3) typically synthesized?

Answer

Pentafluoropropanoic anhydride
Pentafluoropropanoic anhydride is typically synthesized through the condensation of pentafluoropropanoic acid with itself or other compatible anhydrides. The reaction is usually carried out under anhydrous conditions to avoid hydrolysis. Commonly, this is achieved using a molecular sieve to remove trace moisture and ensuring the reaction is performed at low temperatures to minimize side reactions.

About

CAS No 356-42-3
English Name Pentafluoropropanoic anhydride
Molecular Formula C6F10O3
Molecular Weight 310.04 g/mol
SMILES C(=O)(C(C(F)(F)F)(F)F)OC(=O)C(C(F)(F)F)(F)F
InChIKey XETRHNFRKCNWAJ-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pentafluoropropanoic anhydride (CAS: 356-42-3)?

Pentafluoropropanoic anhydride (CAS: 356-42-3) is a colorless liquid with a high molecular weight an...

Compound Q&A

What industries use Pentafluoropropanoic anhydride (CAS: 356-42-3)?

Pentafluoropropanoic anhydride (CAS: 356-42-3) is used in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling Pentafluoropropanoic anhydride (CAS: 356-42-3)?

When handling Pentafluoropropanoic anhydride (CAS: 356-42-3), it is essential to use appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...