Compound Q&A

What industries use Pentafluoropropanoic anhydride (CAS: 356-42-3)?

Answer

Pentafluoropropanoic anhydride
Pentafluoropropanoic anhydride (CAS: 356-42-3) is used in the pharmaceutical industry for the synthesis of certain intermediates and drug compounds. It is also utilized in the polymer industry for the production of fluorinated polymers. Additionally, it finds applications in the semiconductor industry for etching processes and in sensor technology for detecting specific chemicals.

About

CAS No 356-42-3
English Name Pentafluoropropanoic anhydride
Molecular Formula C6F10O3
Molecular Weight 310.04 g/mol
SMILES C(=O)(C(C(F)(F)F)(F)F)OC(=O)C(C(F)(F)F)(F)F
InChIKey XETRHNFRKCNWAJ-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pentafluoropropanoic anhydride (CAS: 356-42-3)?

Pentafluoropropanoic anhydride (CAS: 356-42-3) is a colorless liquid with a high molecular weight an...

Compound Q&A

How is Pentafluoropropanoic anhydride (CAS: 356-42-3) typically synthesized?

Pentafluoropropanoic anhydride is typically synthesized through the condensation of pentafluoropropa...

Compound Q&A

What precautions should be taken when handling Pentafluoropropanoic anhydride (CAS: 356-42-3)?

When handling Pentafluoropropanoic anhydride (CAS: 356-42-3), it is essential to use appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...