Compound Q&A

What are the physical and chemical properties of Pentafluoropropanoic anhydride (CAS: 356-42-3)?

Answer

Pentafluoropropanoic anhydride
Pentafluoropropanoic anhydride (CAS: 356-42-3) is a colorless liquid with a high molecular weight and low solubility in water. It is highly reactive and can undergo hydrolysis and esterification reactions. It has a strong pungent odor. It crystallizes at -12°C and has a boiling point of 116°C.

About

CAS No 356-42-3
English Name Pentafluoropropanoic anhydride
Molecular Formula C6F10O3
Molecular Weight 310.04 g/mol
SMILES C(=O)(C(C(F)(F)F)(F)F)OC(=O)C(C(F)(F)F)(F)F
InChIKey XETRHNFRKCNWAJ-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is Pentafluoropropanoic anhydride (CAS: 356-42-3) typically synthesized?

Pentafluoropropanoic anhydride is typically synthesized through the condensation of pentafluoropropa...

Compound Q&A

What industries use Pentafluoropropanoic anhydride (CAS: 356-42-3)?

Pentafluoropropanoic anhydride (CAS: 356-42-3) is used in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling Pentafluoropropanoic anhydride (CAS: 356-42-3)?

When handling Pentafluoropropanoic anhydride (CAS: 356-42-3), it is essential to use appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...