Compound Q&A

What industries use 4-Nitro-1H-indole (CAS: 4769-97-5)?

Answer

4-Nitro-1H-indole
4-Nitro-1H-indole (CAS: 4769-97-5) is used in the pharmaceutical industry for the synthesis of certain drugs. It also finds applications in the production of dyes and pigments. Additionally, it is used in the development of sensors and as a precursor in the synthesis of semiconductors.

About

CAS No 4769-97-5
English Name 4-Nitro-1H-indole
Molecular Formula C8H6N2O2
Molecular Weight 162.15 g/mol
SMILES C1=CC2=C(C=CN2)C(=C1)[N+](=O)[O-]
InChIKey LAVZKLJDKGRZJG-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Nitro-1H-indole (CAS: 4769-97-5)?

4-Nitro-1H-indole (CAS: 4769-97-5) is a yellow crystalline solid with a molecular weight of 177.08 g...

Compound Q&A

How is 4-Nitro-1H-indole (CAS: 4769-97-5) typically synthesized?

4-Nitro-1H-indole (CAS: 4769-97-5) is typically synthesized by the nitration of indole. A mixture of...

Compound Q&A

What precautions should be taken when handling 4-Nitro-1H-indole (CAS: 4769-97-5)?

When handling 4-Nitro-1H-indole (CAS: 4769-97-5), it is crucial to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...