Compound Q&A

What are the physical and chemical properties of 4-Nitro-1H-indole (CAS: 4769-97-5)?

Answer

4-Nitro-1H-indole
4-Nitro-1H-indole (CAS: 4769-97-5) is a yellow crystalline solid with a molecular weight of 177.08 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol. It is moderately reactive and can undergo nitration and reduction reactions. The compound is stable under normal conditions but should be stored away from heat and reducing agents.

About

CAS No 4769-97-5
English Name 4-Nitro-1H-indole
Molecular Formula C8H6N2O2
Molecular Weight 162.15 g/mol
SMILES C1=CC2=C(C=CN2)C(=C1)[N+](=O)[O-]
InChIKey LAVZKLJDKGRZJG-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

How is 4-Nitro-1H-indole (CAS: 4769-97-5) typically synthesized?

4-Nitro-1H-indole (CAS: 4769-97-5) is typically synthesized by the nitration of indole. A mixture of...

Compound Q&A

What industries use 4-Nitro-1H-indole (CAS: 4769-97-5)?

4-Nitro-1H-indole (CAS: 4769-97-5) is used in the pharmaceutical industry for the synthesis of certa...

Compound Q&A

What precautions should be taken when handling 4-Nitro-1H-indole (CAS: 4769-97-5)?

When handling 4-Nitro-1H-indole (CAS: 4769-97-5), it is crucial to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...