Compound Q&A

How is 4-Nitro-1H-indole (CAS: 4769-97-5) typically synthesized?

Answer

4-Nitro-1H-indole
4-Nitro-1H-indole (CAS: 4769-97-5) is typically synthesized by the nitration of indole. A mixture of indole and sulfuric acid is treated with a nitric acid solution. The process is carried out in a water bath to maintain the temperature and ensure a high yield. The product is then purified by recrystallization.

About

CAS No 4769-97-5
English Name 4-Nitro-1H-indole
Molecular Formula C8H6N2O2
Molecular Weight 162.15 g/mol
SMILES C1=CC2=C(C=CN2)C(=C1)[N+](=O)[O-]
InChIKey LAVZKLJDKGRZJG-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Nitro-1H-indole (CAS: 4769-97-5)?

4-Nitro-1H-indole (CAS: 4769-97-5) is a yellow crystalline solid with a molecular weight of 177.08 g...

Compound Q&A

What industries use 4-Nitro-1H-indole (CAS: 4769-97-5)?

4-Nitro-1H-indole (CAS: 4769-97-5) is used in the pharmaceutical industry for the synthesis of certa...

Compound Q&A

What precautions should be taken when handling 4-Nitro-1H-indole (CAS: 4769-97-5)?

When handling 4-Nitro-1H-indole (CAS: 4769-97-5), it is crucial to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...