Compound Q&A

What industries use 3-[2-(Trifluoromethyl)phenyl]acrylic acid (CAS: 2062-25-1)?

Answer

3-[2-(Trifluoromethyl)phenyl]acrylic acid
3-[2-(Trifluoromethyl)phenyl]acrylic acid finds applications in various industries. It is used in the pharmaceutical sector for the synthesis of certain drugs and intermediates. In the polymer industry, it serves as a monomer for the production of speciality polymers. Additionally, it is utilized in the development of sensors and semiconductors due to its unique physicochemical properties.

About

CAS No 2062-25-1
English Name 3-[2-(Trifluoromethyl)phenyl]acrylic acid
Molecular Formula C10H7F3O2
Molecular Weight 216.16 g/mol
SMILES C1=CC=C(C(=C1)C=CC(=O)O)C(F)(F)F
InChIKey AMVYAIXPAGBXOM-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-[2-(Trifluoromethyl)phenyl]acrylic acid (CAS: 2062-25-1)?

3-[2-(Trifluoromethyl)phenyl]acrylic acid (CAS: 2062-25-1) is a white to off-white crystalline solid...

Compound Q&A

How is 3-[2-(Trifluoromethyl)phenyl]acrylic acid (CAS: 2062-25-1) typically synthesized?

3-[2-(Trifluoromethyl)phenyl]acrylic acid is typically synthesized via the reaction of 2-(trifluorom...

Compound Q&A

What precautions should be taken when handling 3-[2-(Trifluoromethyl)phenyl]acrylic acid (CAS: 2062-25-1)?

When handling 3-[2-(Trifluoromethyl)phenyl]acrylic acid (CAS: 2062-25-1), it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...