Compound Q&A

How is 3-[2-(Trifluoromethyl)phenyl]acrylic acid (CAS: 2062-25-1) typically synthesized?

Answer

3-[2-(Trifluoromethyl)phenyl]acrylic acid
3-[2-(Trifluoromethyl)phenyl]acrylic acid is typically synthesized via the reaction of 2-(trifluoromethyl)phenylacetyl chloride with sodium hydroxide in a polar aprotic solvent like dimethylformamide (DMF). The process involves the nucleophilic attack of the hydroxide ion on the acetyl chloride group, followed by dehydration to form the carboxylic acid. Common catalysts include triethylamine and 4-dimethylaminopyridine (DMAP) to improve selectivity and yield.

About

CAS No 2062-25-1
English Name 3-[2-(Trifluoromethyl)phenyl]acrylic acid
Molecular Formula C10H7F3O2
Molecular Weight 216.16 g/mol
SMILES C1=CC=C(C(=C1)C=CC(=O)O)C(F)(F)F
InChIKey AMVYAIXPAGBXOM-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-[2-(Trifluoromethyl)phenyl]acrylic acid (CAS: 2062-25-1)?

3-[2-(Trifluoromethyl)phenyl]acrylic acid (CAS: 2062-25-1) is a white to off-white crystalline solid...

Compound Q&A

What industries use 3-[2-(Trifluoromethyl)phenyl]acrylic acid (CAS: 2062-25-1)?

3-[2-(Trifluoromethyl)phenyl]acrylic acid finds applications in various industries. It is used in th...

Compound Q&A

What precautions should be taken when handling 3-[2-(Trifluoromethyl)phenyl]acrylic acid (CAS: 2062-25-1)?

When handling 3-[2-(Trifluoromethyl)phenyl]acrylic acid (CAS: 2062-25-1), it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...