Compound Q&A

What are the physical and chemical properties of 3-[2-(Trifluoromethyl)phenyl]acrylic acid (CAS: 2062-25-1)?

Answer

3-[2-(Trifluoromethyl)phenyl]acrylic acid
3-[2-(Trifluoromethyl)phenyl]acrylic acid (CAS: 2062-25-1) is a white to off-white crystalline solid. Its molecular weight is approximately 249.12 g/mol. This compound is poorly soluble in water but soluble in organic solvents like ethanol and acetonitrile. It is moderately reactive, particularly under basic conditions, and can undergo esterification and amidation reactions. It is stable under typical laboratory conditions but should be stored in a cool, dry place away from direct sunlight.

About

CAS No 2062-25-1
English Name 3-[2-(Trifluoromethyl)phenyl]acrylic acid
Molecular Formula C10H7F3O2
Molecular Weight 216.16 g/mol
SMILES C1=CC=C(C(=C1)C=CC(=O)O)C(F)(F)F
InChIKey AMVYAIXPAGBXOM-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

How is 3-[2-(Trifluoromethyl)phenyl]acrylic acid (CAS: 2062-25-1) typically synthesized?

3-[2-(Trifluoromethyl)phenyl]acrylic acid is typically synthesized via the reaction of 2-(trifluorom...

Compound Q&A

What industries use 3-[2-(Trifluoromethyl)phenyl]acrylic acid (CAS: 2062-25-1)?

3-[2-(Trifluoromethyl)phenyl]acrylic acid finds applications in various industries. It is used in th...

Compound Q&A

What precautions should be taken when handling 3-[2-(Trifluoromethyl)phenyl]acrylic acid (CAS: 2062-25-1)?

When handling 3-[2-(Trifluoromethyl)phenyl]acrylic acid (CAS: 2062-25-1), it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...