Compound Q&A

What industries use 4-(3-Oxobutyl)phenyl acetate (CAS: 3572-06-3)?

Answer

4-(3-Oxobutyl)phenyl acetate
4-(3-Oxobutyl)phenyl acetate is used in the pharmaceutical industry for the preparation of certain drug intermediates due to its chemical functional groups. It is also utilized in the polymer industry for modifying the properties of synthetic polymers. Additionally, it finds applications in the sensor technology sector for chemical sensing applications. Its use in semiconductors is limited but can be explored for specific material properties.

About

CAS No 3572-06-3
English Name 4-(3-Oxobutyl)phenyl acetate
Molecular Formula C12H14O3
Molecular Weight 206.24 g/mol
SMILES CC(=O)CCc1ccc(cc1)OC(=O)C
InChIKey UMIKWXDGXDJQJK-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(3-Oxobutyl)phenyl acetate (CAS: 3572-06-3)?

4-(3-Oxobutyl)phenyl acetate is a colorless liquid with a molecular weight of approximately 212.26 g...

Compound Q&A

How is 4-(3-Oxobutyl)phenyl acetate (CAS: 3572-06-3) typically synthesized?

4-(3-Oxobutyl)phenyl acetate is typically synthesized via the esterification of 4-(3-oxobutyl)phenol...

Compound Q&A

What precautions should be taken when handling 4-(3-Oxobutyl)phenyl acetate (CAS: 3572-06-3)?

Proper personal protective equipment (PPE) is essential when handling 4-(3-Oxobutyl)phenyl acetate, ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...