Compound Q&A

What are the physical and chemical properties of 4-(3-Oxobutyl)phenyl acetate (CAS: 3572-06-3)?

Answer

4-(3-Oxobutyl)phenyl acetate
4-(3-Oxobutyl)phenyl acetate is a colorless liquid with a molecular weight of approximately 212.26 g/mol. It is poorly soluble in water but soluble in organic solvents like ethanol and acetone. This compound is moderately reactive, particularly towards nucleophilic substitution reactions. Its vapor pressure is low, and it exhibits typical ester properties with respect to reactivity and acidity.

About

CAS No 3572-06-3
English Name 4-(3-Oxobutyl)phenyl acetate
Molecular Formula C12H14O3
Molecular Weight 206.24 g/mol
SMILES CC(=O)CCc1ccc(cc1)OC(=O)C
InChIKey UMIKWXDGXDJQJK-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

How is 4-(3-Oxobutyl)phenyl acetate (CAS: 3572-06-3) typically synthesized?

4-(3-Oxobutyl)phenyl acetate is typically synthesized via the esterification of 4-(3-oxobutyl)phenol...

Compound Q&A

What industries use 4-(3-Oxobutyl)phenyl acetate (CAS: 3572-06-3)?

4-(3-Oxobutyl)phenyl acetate is used in the pharmaceutical industry for the preparation of certain d...

Compound Q&A

What precautions should be taken when handling 4-(3-Oxobutyl)phenyl acetate (CAS: 3572-06-3)?

Proper personal protective equipment (PPE) is essential when handling 4-(3-Oxobutyl)phenyl acetate, ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...