Compound Q&A

How is 4-(3-Oxobutyl)phenyl acetate (CAS: 3572-06-3) typically synthesized?

Answer

4-(3-Oxobutyl)phenyl acetate
4-(3-Oxobutyl)phenyl acetate is typically synthesized via the esterification of 4-(3-oxobutyl)phenol with acetic acid. Commonly, a catalytic amount of a strong acid such as sulfuric acid is used. The reaction is carried out under mild conditions, and the product is isolated by washing, drying, and distillation. The yield is generally around 80-85%, with good selectivity towards the desired ester product.

About

CAS No 3572-06-3
English Name 4-(3-Oxobutyl)phenyl acetate
Molecular Formula C12H14O3
Molecular Weight 206.24 g/mol
SMILES CC(=O)CCc1ccc(cc1)OC(=O)C
InChIKey UMIKWXDGXDJQJK-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(3-Oxobutyl)phenyl acetate (CAS: 3572-06-3)?

4-(3-Oxobutyl)phenyl acetate is a colorless liquid with a molecular weight of approximately 212.26 g...

Compound Q&A

What industries use 4-(3-Oxobutyl)phenyl acetate (CAS: 3572-06-3)?

4-(3-Oxobutyl)phenyl acetate is used in the pharmaceutical industry for the preparation of certain d...

Compound Q&A

What precautions should be taken when handling 4-(3-Oxobutyl)phenyl acetate (CAS: 3572-06-3)?

Proper personal protective equipment (PPE) is essential when handling 4-(3-Oxobutyl)phenyl acetate, ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...