Compound Q&A

What precautions should be taken when handling 2-(4-Nitrophenyl)ethanol (CAS: 100-27-6)?

Answer

2-(4-Nitrophenyl)ethanol
When handling 2-(4-Nitrophenyl)ethanol (CAS: 100-27-6), ensure appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to minimize inhalation. Store in a cool, dry place away from direct sunlight and heat sources. In case of spill, immediately clean up using appropriate materials and consult the Safety Data Sheet (SDS) for detailed emergency procedures.

About

CAS No 100-27-6
English Name 2-(4-Nitrophenyl)ethanol
Molecular Formula C8H9NO3
Molecular Weight 167.16 g/mol
SMILES C1=CC(=CC=C1CCO)[N+](=O)[O-]
InChIKey IKMXRUOZUUKSON-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(4-Nitrophenyl)ethanol (CAS: 100-27-6)?

2-(4-Nitrophenyl)ethanol (CAS: 100-27-6) is a colorless to light yellow liquid with a molecular weig...

Compound Q&A

How is 2-(4-Nitrophenyl)ethanol (CAS: 100-27-6) typically synthesized?

2-(4-Nitrophenyl)ethanol (CAS: 100-27-6) is synthesized by the nitration of 2-phenylethanol followed...

Compound Q&A

What industries use 2-(4-Nitrophenyl)ethanol (CAS: 100-27-6)?

2-(4-Nitrophenyl)ethanol (CAS: 100-27-6) is primarily used in the pharmaceutical industry as an inte...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...