Compound Q&A

What are the physical and chemical properties of 2-(4-Nitrophenyl)ethanol (CAS: 100-27-6)?

Answer

2-(4-Nitrophenyl)ethanol
2-(4-Nitrophenyl)ethanol (CAS: 100-27-6) is a colorless to light yellow liquid with a molecular weight of approximately 198.14 g/mol. It has a density of about 1.08 g/cm³ and a boiling point of around 188°C. This compound is moderately soluble in water and readily soluble in organic solvents like ethanol and acetone. It is not highly reactive under normal conditions but can undergo nitro reduction.

About

CAS No 100-27-6
English Name 2-(4-Nitrophenyl)ethanol
Molecular Formula C8H9NO3
Molecular Weight 167.16 g/mol
SMILES C1=CC(=CC=C1CCO)[N+](=O)[O-]
InChIKey IKMXRUOZUUKSON-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

How is 2-(4-Nitrophenyl)ethanol (CAS: 100-27-6) typically synthesized?

2-(4-Nitrophenyl)ethanol (CAS: 100-27-6) is synthesized by the nitration of 2-phenylethanol followed...

Compound Q&A

What industries use 2-(4-Nitrophenyl)ethanol (CAS: 100-27-6)?

2-(4-Nitrophenyl)ethanol (CAS: 100-27-6) is primarily used in the pharmaceutical industry as an inte...

Compound Q&A

What precautions should be taken when handling 2-(4-Nitrophenyl)ethanol (CAS: 100-27-6)?

When handling 2-(4-Nitrophenyl)ethanol (CAS: 100-27-6), ensure appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...