Compound Q&A

What industries use Diphenyliodonium chloride (CAS: 1483-72-3)?

Answer

Diphenyliodonium chloride
Diphenyliodonium chloride is used in the pharmaceutical industry for the synthesis of certain drugs, in the polymer industry for the modification of polymers, and in the semiconductor industry for etching processes. It is also utilized in the production of sensors and in organic chemistry for various transformations.

About

CAS No 1483-72-3
English Name Diphenyliodonium chloride
Molecular Formula C12H10ClI
Molecular Weight 316.56 g/mol
SMILES C1=CC=C(C=C1)[I+]C2=CC=CC=C2.[Cl-]
InChIKey RSJLWBUYLGJOBD-UHFFFAOYSA-M
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diphenyliodonium chloride (CAS: 1483-72-3)?

Diphenyliodonium chloride is a crystalline compound with a molecular weight of 286.17 g/mol. It has ...

Compound Q&A

How is Diphenyliodonium chloride (CAS: 1483-72-3) typically synthesized?

Diphenyliodonium chloride is typically synthesized by the reaction of phenyllithium with iodine in a...

Compound Q&A

What precautions should be taken when handling Diphenyliodonium chloride (CAS: 1483-72-3)?

When handling Diphenyliodonium chloride, it is essential to wear appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...