Compound Q&A

What are the physical and chemical properties of Diphenyliodonium chloride (CAS: 1483-72-3)?

Answer

Diphenyliodonium chloride
Diphenyliodonium chloride is a crystalline compound with a molecular weight of 286.17 g/mol. It has a low solubility in water but is more soluble in organic solvents like dichloromethane. Chemically, it is a strong oxidizing agent and can react with reducing agents. It is stable under normal conditions but should be handled with care due to its reactivity.

About

CAS No 1483-72-3
English Name Diphenyliodonium chloride
Molecular Formula C12H10ClI
Molecular Weight 316.56 g/mol
SMILES C1=CC=C(C=C1)[I+]C2=CC=CC=C2.[Cl-]
InChIKey RSJLWBUYLGJOBD-UHFFFAOYSA-M
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

How is Diphenyliodonium chloride (CAS: 1483-72-3) typically synthesized?

Diphenyliodonium chloride is typically synthesized by the reaction of phenyllithium with iodine in a...

Compound Q&A

What industries use Diphenyliodonium chloride (CAS: 1483-72-3)?

Diphenyliodonium chloride is used in the pharmaceutical industry for the synthesis of certain drugs,...

Compound Q&A

What precautions should be taken when handling Diphenyliodonium chloride (CAS: 1483-72-3)?

When handling Diphenyliodonium chloride, it is essential to wear appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...