Compound Q&A

How is Diphenyliodonium chloride (CAS: 1483-72-3) typically synthesized?

Answer

Diphenyliodonium chloride
Diphenyliodonium chloride is typically synthesized by the reaction of phenyllithium with iodine in an inert solvent such as THF. The process involves the formation of phenyl iodide, which then reacts with another equivalent of phenyllithium to form the diphenyliodonium ion. This ion then reacts with chloride to give the final product. The yield is generally high, and the reaction is carried out under anhydrous conditions.

About

CAS No 1483-72-3
English Name Diphenyliodonium chloride
Molecular Formula C12H10ClI
Molecular Weight 316.56 g/mol
SMILES C1=CC=C(C=C1)[I+]C2=CC=CC=C2.[Cl-]
InChIKey RSJLWBUYLGJOBD-UHFFFAOYSA-M
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diphenyliodonium chloride (CAS: 1483-72-3)?

Diphenyliodonium chloride is a crystalline compound with a molecular weight of 286.17 g/mol. It has ...

Compound Q&A

What industries use Diphenyliodonium chloride (CAS: 1483-72-3)?

Diphenyliodonium chloride is used in the pharmaceutical industry for the synthesis of certain drugs,...

Compound Q&A

What precautions should be taken when handling Diphenyliodonium chloride (CAS: 1483-72-3)?

When handling Diphenyliodonium chloride, it is essential to wear appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...