Compound Q&A

What industries use 2-Bromo-3-nitropyridine (CAS: 19755-53-4)?

Answer

2-Bromo-3-nitropyridine
2-Bromo-3-nitropyridine is used in the pharmaceutical industry for the synthesis of certain medicinal compounds. It also finds applications in the development of sensors and semiconductors due to its electronic properties.

About

CAS No 19755-53-4
English Name 2-Bromo-3-nitropyridine
Molecular Formula C5H3BrN2O2
Molecular Weight 202.99 g/mol
SMILES C1=CC(=C(N=C1)Br)[N+](=O)[O-]
InChIKey ZCCUFLITCDHRMG-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-3-nitropyridine (CAS: 19755-53-4)?

2-Bromo-3-nitropyridine is a crystalline solid with a molecular weight of approximately 228.03 g/mol...

Compound Q&A

How is 2-Bromo-3-nitropyridine (CAS: 19755-53-4) typically synthesized?

2-Bromo-3-nitropyridine is typically synthesized through the nitration of 2-bromopyridine followed b...

Compound Q&A

What precautions should be taken when handling 2-Bromo-3-nitropyridine (CAS: 19755-53-4)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat is essential when...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...