Compound Q&A

What are the physical and chemical properties of 2-Bromo-3-nitropyridine (CAS: 19755-53-4)?

Answer

2-Bromo-3-nitropyridine
2-Bromo-3-nitropyridine is a crystalline solid with a molecular weight of approximately 228.03 g/mol. It has a melting point of around 115-118°C and is slightly soluble in most common organic solvents. It shows significant reactivity towards nucleophiles and can undergo substitution reactions at the bromine and nitro groups.

About

CAS No 19755-53-4
English Name 2-Bromo-3-nitropyridine
Molecular Formula C5H3BrN2O2
Molecular Weight 202.99 g/mol
SMILES C1=CC(=C(N=C1)Br)[N+](=O)[O-]
InChIKey ZCCUFLITCDHRMG-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

How is 2-Bromo-3-nitropyridine (CAS: 19755-53-4) typically synthesized?

2-Bromo-3-nitropyridine is typically synthesized through the nitration of 2-bromopyridine followed b...

Compound Q&A

What industries use 2-Bromo-3-nitropyridine (CAS: 19755-53-4)?

2-Bromo-3-nitropyridine is used in the pharmaceutical industry for the synthesis of certain medicina...

Compound Q&A

What precautions should be taken when handling 2-Bromo-3-nitropyridine (CAS: 19755-53-4)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat is essential when...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...