Compound Q&A

What precautions should be taken when handling Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9)?

Answer

Bis(2,4,6-trichlorophenyl) oxalate
When handling Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. This compound should be handled in a well-ventilated area or within a fume hood due to its potential to release volatile chlorine compounds. In case of spills, immediately clean up any contaminated areas using suitable absorbents and follow the safety data sheet (SDS) guidelines for disposal. Always refer to the most current SDS for specific handling instructions.

About

CAS No 1165-91-9
English Name Bis(2,4,6-trichlorophenyl) oxalate
Molecular Formula C14H4Cl6O4
Molecular Weight 448.9 g/mol
SMILES C1=C(C=C(C(=C1Cl)OC(=O)C(=O)OC2=C(C=C(C=C2Cl)Cl)Cl)Cl)Cl
InChIKey GEVPIWPYWJZSPR-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9)?

Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9) is a crystalline solid with a molecular weight o...

Compound Q&A

How is Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9) typically synthesized?

Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9) is synthesized through the reaction of oxalic ac...

Compound Q&A

What industries use Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9)?

Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9) is primarily used in the electronics industry fo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...