Compound Q&A

What industries use Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9)?

Answer

Bis(2,4,6-trichlorophenyl) oxalate
Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9) is primarily used in the electronics industry for the production of high-temperature resistant polymers and as a heat stabilizer in semiconductor applications. It also finds application in the pharmaceutical industry for its unique thermal and chemical properties, making it ideal for use in controlled release drug formulations and sensor technologies.

About

CAS No 1165-91-9
English Name Bis(2,4,6-trichlorophenyl) oxalate
Molecular Formula C14H4Cl6O4
Molecular Weight 448.9 g/mol
SMILES C1=C(C=C(C(=C1Cl)OC(=O)C(=O)OC2=C(C=C(C=C2Cl)Cl)Cl)Cl)Cl
InChIKey GEVPIWPYWJZSPR-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9)?

Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9) is a crystalline solid with a molecular weight o...

Compound Q&A

How is Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9) typically synthesized?

Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9) is synthesized through the reaction of oxalic ac...

Compound Q&A

What precautions should be taken when handling Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9)?

When handling Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9), it is essential to use appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...