Compound Q&A

How is Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9) typically synthesized?

Answer

Bis(2,4,6-trichlorophenyl) oxalate
Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9) is synthesized through the reaction of oxalic acid with 2,4,6-trichlorophenol. The synthesis typically involves careful control of temperature and pH to ensure the formation of the desired oxalate ester. The process yields a high purity product with good selectivity and a yield of about 85-90%. Commonly used solvents include toluene and dichloromethane.

About

CAS No 1165-91-9
English Name Bis(2,4,6-trichlorophenyl) oxalate
Molecular Formula C14H4Cl6O4
Molecular Weight 448.9 g/mol
SMILES C1=C(C=C(C(=C1Cl)OC(=O)C(=O)OC2=C(C=C(C=C2Cl)Cl)Cl)Cl)Cl
InChIKey GEVPIWPYWJZSPR-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9)?

Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9) is a crystalline solid with a molecular weight o...

Compound Q&A

What industries use Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9)?

Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9) is primarily used in the electronics industry fo...

Compound Q&A

What precautions should be taken when handling Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9)?

When handling Bis(2,4,6-trichlorophenyl) oxalate (CAS: 1165-91-9), it is essential to use appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...