Compound Q&A

What precautions should be taken when handling 2-(2,4-Dichlorobenzyl)-1H-benzimidazole (CAS: 154660-96-5)?

Answer

2-(2,4-Dichlorobenzyl)-1H-benzimidazole
When handling 2-(2,4-Dichlorobenzyl)-1H-benzimidazole, ensure the use of appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or fume hood to minimize inhalation. Spills should be cleaned up using appropriate absorbent materials, and the area should be thoroughly rinsed. Always refer to the safety data sheet (SDS) for detailed handling instructions and emergency procedures.

About

English Name 2-(2,4-Dichlorobenzyl)-1H-benzimidazole
Molecular Formula C14H10Cl2N2
Molecular Weight 277.15 g/mol
SMILES C1=CC=C2C(=C1)NC(=N2)CC3=C(C=C(C=C3)Cl)Cl
InChIKey OIHHDYNKEHASLI-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2,4-Dichlorobenzyl)-1H-benzimidazole (CAS: 154660-96-5)?

2-(2,4-Dichlorobenzyl)-1H-benzimidazole is a crystalline compound with a molecular weight of approxi...

Compound Q&A

How is 2-(2,4-Dichlorobenzyl)-1H-benzimidazole (CAS: 154660-96-5) typically synthesized?

2-(2,4-Dichlorobenzyl)-1H-benzimidazole is commonly synthesized via the condensation of 2,4-dichloro...

Compound Q&A

What industries use 2-(2,4-Dichlorobenzyl)-1H-benzimidazole (CAS: 154660-96-5)?

2-(2,4-Dichlorobenzyl)-1H-benzimidazole is primarily used in the pharmaceutical industry for its bio...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...