Compound Q&A

What industries use 2-(2,4-Dichlorobenzyl)-1H-benzimidazole (CAS: 154660-96-5)?

Answer

2-(2,4-Dichlorobenzyl)-1H-benzimidazole
2-(2,4-Dichlorobenzyl)-1H-benzimidazole is primarily used in the pharmaceutical industry for its biological activity, particularly as a potential antiviral and antitumor agent. It is also explored in the sensor industry due to its unique chemical and physical properties, making it suitable for detecting specific chemical species.

About

English Name 2-(2,4-Dichlorobenzyl)-1H-benzimidazole
Molecular Formula C14H10Cl2N2
Molecular Weight 277.15 g/mol
SMILES C1=CC=C2C(=C1)NC(=N2)CC3=C(C=C(C=C3)Cl)Cl
InChIKey OIHHDYNKEHASLI-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2,4-Dichlorobenzyl)-1H-benzimidazole (CAS: 154660-96-5)?

2-(2,4-Dichlorobenzyl)-1H-benzimidazole is a crystalline compound with a molecular weight of approxi...

Compound Q&A

How is 2-(2,4-Dichlorobenzyl)-1H-benzimidazole (CAS: 154660-96-5) typically synthesized?

2-(2,4-Dichlorobenzyl)-1H-benzimidazole is commonly synthesized via the condensation of 2,4-dichloro...

Compound Q&A

What precautions should be taken when handling 2-(2,4-Dichlorobenzyl)-1H-benzimidazole (CAS: 154660-96-5)?

When handling 2-(2,4-Dichlorobenzyl)-1H-benzimidazole, ensure the use of appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...