Compound Q&A

How is 2-(2,4-Dichlorobenzyl)-1H-benzimidazole (CAS: 154660-96-5) typically synthesized?

Answer

2-(2,4-Dichlorobenzyl)-1H-benzimidazole
2-(2,4-Dichlorobenzyl)-1H-benzimidazole is commonly synthesized via the condensation of 2,4-dichlorobenzyl chlorides with 1H-benzimidazole. This reaction is typically catalyzed by a basic reagent like triethylamine and proceeds with good yield and selectivity. The process involves careful control of reaction conditions to avoid side reactions.

About

English Name 2-(2,4-Dichlorobenzyl)-1H-benzimidazole
Molecular Formula C14H10Cl2N2
Molecular Weight 277.15 g/mol
SMILES C1=CC=C2C(=C1)NC(=N2)CC3=C(C=C(C=C3)Cl)Cl
InChIKey OIHHDYNKEHASLI-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2,4-Dichlorobenzyl)-1H-benzimidazole (CAS: 154660-96-5)?

2-(2,4-Dichlorobenzyl)-1H-benzimidazole is a crystalline compound with a molecular weight of approxi...

Compound Q&A

What industries use 2-(2,4-Dichlorobenzyl)-1H-benzimidazole (CAS: 154660-96-5)?

2-(2,4-Dichlorobenzyl)-1H-benzimidazole is primarily used in the pharmaceutical industry for its bio...

Compound Q&A

What precautions should be taken when handling 2-(2,4-Dichlorobenzyl)-1H-benzimidazole (CAS: 154660-96-5)?

When handling 2-(2,4-Dichlorobenzyl)-1H-benzimidazole, ensure the use of appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...