Compound Q&A

What precautions should be taken when handling heptafluorobutanoic anhydride (CAS: 336-59-4)?

Answer

Heptafluorobutanoic anhydride
When handling heptafluorobutanoic anhydride (CAS: 336-59-4), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. This compound should be handled in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up carefully using appropriate absorbents and disposing of them according to local regulations. Safety data sheets (SDS) should be consulted for detailed handling and disposal procedures.

About

CAS No 336-59-4
English Name Heptafluorobutanoic anhydride
Molecular Formula C8F14O3
Molecular Weight 410.06 g/mol
SMILES C(=O)(C(C(C(F)(F)F)(F)F)(F)F)OC(=O)C(C(C(F)(F)F)(F)F)(F)F
InChIKey UFFSXJKVKBQEHC-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Heptafluorobutanoic anhydride (CAS: 336-59-4)?

Heptafluorobutanoic anhydride (CAS: 336-59-4) is a crystalline compound with a molecular weight of a...

Compound Q&A

How is heptafluorobutanoic anhydride (CAS: 336-59-4) typically synthesized?

Heptafluorobutanoic anhydride (CAS: 336-59-4) is typically synthesized by the condensation of heptaf...

Compound Q&A

What industries use heptafluorobutanoic anhydride (CAS: 336-59-4)?

Heptafluorobutanoic anhydride (CAS: 336-59-4) is primarily used in the pharmaceutical industry for t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...