Compound Q&A

What industries use heptafluorobutanoic anhydride (CAS: 336-59-4)?

Answer

Heptafluorobutanoic anhydride
Heptafluorobutanoic anhydride (CAS: 336-59-4) is primarily used in the pharmaceutical industry for the synthesis of fluorinated compounds with potential medicinal applications. It is also used in the polymer industry for modifying polymers to improve their stability and fluorination properties. Additionally, it has applications in the production of sensors and semiconductors where its reactivity and fluorine content are advantageous.

About

CAS No 336-59-4
English Name Heptafluorobutanoic anhydride
Molecular Formula C8F14O3
Molecular Weight 410.06 g/mol
SMILES C(=O)(C(C(C(F)(F)F)(F)F)(F)F)OC(=O)C(C(C(F)(F)F)(F)F)(F)F
InChIKey UFFSXJKVKBQEHC-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Heptafluorobutanoic anhydride (CAS: 336-59-4)?

Heptafluorobutanoic anhydride (CAS: 336-59-4) is a crystalline compound with a molecular weight of a...

Compound Q&A

How is heptafluorobutanoic anhydride (CAS: 336-59-4) typically synthesized?

Heptafluorobutanoic anhydride (CAS: 336-59-4) is typically synthesized by the condensation of heptaf...

Compound Q&A

What precautions should be taken when handling heptafluorobutanoic anhydride (CAS: 336-59-4)?

When handling heptafluorobutanoic anhydride (CAS: 336-59-4), it is essential to use appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...