Compound Q&A

How is heptafluorobutanoic anhydride (CAS: 336-59-4) typically synthesized?

Answer

Heptafluorobutanoic anhydride
Heptafluorobutanoic anhydride (CAS: 336-59-4) is typically synthesized by the condensation of heptafluorobutanoic acid with itself in the presence of a suitable catalyst like anhydrous aluminum chloride. This reaction is exothermic and requires careful temperature control to achieve high yield and selectivity. The product is isolated by distillation under reduced pressure.

About

CAS No 336-59-4
English Name Heptafluorobutanoic anhydride
Molecular Formula C8F14O3
Molecular Weight 410.06 g/mol
SMILES C(=O)(C(C(C(F)(F)F)(F)F)(F)F)OC(=O)C(C(C(F)(F)F)(F)F)(F)F
InChIKey UFFSXJKVKBQEHC-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Heptafluorobutanoic anhydride (CAS: 336-59-4)?

Heptafluorobutanoic anhydride (CAS: 336-59-4) is a crystalline compound with a molecular weight of a...

Compound Q&A

What industries use heptafluorobutanoic anhydride (CAS: 336-59-4)?

Heptafluorobutanoic anhydride (CAS: 336-59-4) is primarily used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling heptafluorobutanoic anhydride (CAS: 336-59-4)?

When handling heptafluorobutanoic anhydride (CAS: 336-59-4), it is essential to use appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...