Compound Q&A

What are the physical and chemical properties of Heptafluorobutanoic anhydride (CAS: 336-59-4)?

Answer

Heptafluorobutanoic anhydride
Heptafluorobutanoic anhydride (CAS: 336-59-4) is a crystalline compound with a molecular weight of approximately 232.07 g/mol. It is highly soluble in organic solvents but has limited solubility in water. This anhydride is known for its strong reactivity towards amines and nucleophiles. It exhibits high stability under normal conditions but can react with moisture and amines to form heptafluorobutan-3-ol and fluoride ions.

About

CAS No 336-59-4
English Name Heptafluorobutanoic anhydride
Molecular Formula C8F14O3
Molecular Weight 410.06 g/mol
SMILES C(=O)(C(C(C(F)(F)F)(F)F)(F)F)OC(=O)C(C(C(F)(F)F)(F)F)(F)F
InChIKey UFFSXJKVKBQEHC-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is heptafluorobutanoic anhydride (CAS: 336-59-4) typically synthesized?

Heptafluorobutanoic anhydride (CAS: 336-59-4) is typically synthesized by the condensation of heptaf...

Compound Q&A

What industries use heptafluorobutanoic anhydride (CAS: 336-59-4)?

Heptafluorobutanoic anhydride (CAS: 336-59-4) is primarily used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling heptafluorobutanoic anhydride (CAS: 336-59-4)?

When handling heptafluorobutanoic anhydride (CAS: 336-59-4), it is essential to use appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...