Compound Q&A

What precautions should be taken when handling Polyquaternium 7 (CAS: 26590-05-6)?

Answer

Polyquaternium 7
When handling Polyquaternium 7 (CAS: 26590-05-6), it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be stored in a dry, well-ventilated area away from direct sunlight and heat sources. In case of a spill, the area should be immediately flushed with water, and appropriate safety data sheets (SDS) should be consulted for detailed spill cleanup procedures.

About

CAS No 26590-05-6
English Name Polyquaternium 7
Molecular Formula C11H21ClN2O
Molecular Weight 232.75 g/mol
SMILES C[N+](C)(CC=C)CC=C.C=CC(=O)N.[Cl-]
InChIKey XFOSBZOUUACCCN-UHFFFAOYSA-M
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Polyquaternium 7 (CAS: 26590-05-6)?

Polyquaternium 7 (CAS: 26590-05-6) is a water-soluble polymer characterized by its crystalline form....

Compound Q&A

How is Polyquaternium 7 (CAS: 26590-05-6) typically synthesized?

Polyquaternium 7 (CAS: 26590-05-6) is synthesized through the polymerization of 2-vinylpyridine with...

Compound Q&A

What industries use Polyquaternium 7 (CAS: 26590-05-6)?

Polyquaternium 7 (CAS: 26590-05-6) is widely used in the cosmetic and personal care industries for i...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...