Compound Q&A

How is Polyquaternium 7 (CAS: 26590-05-6) typically synthesized?

Answer

Polyquaternium 7
Polyquaternium 7 (CAS: 26590-05-6) is synthesized through the polymerization of 2-vinylpyridine with quaternary ammonium compounds. Common synthesis methods include free radical polymerization, where initiators like benzoyl peroxide are used. The reaction is typically conducted in aqueous media, ensuring good solubility. The process yields high molecular weight polymers with a high degree of selectivity and good yields.

About

CAS No 26590-05-6
English Name Polyquaternium 7
Molecular Formula C11H21ClN2O
Molecular Weight 232.75 g/mol
SMILES C[N+](C)(CC=C)CC=C.C=CC(=O)N.[Cl-]
InChIKey XFOSBZOUUACCCN-UHFFFAOYSA-M
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Polyquaternium 7 (CAS: 26590-05-6)?

Polyquaternium 7 (CAS: 26590-05-6) is a water-soluble polymer characterized by its crystalline form....

Compound Q&A

What industries use Polyquaternium 7 (CAS: 26590-05-6)?

Polyquaternium 7 (CAS: 26590-05-6) is widely used in the cosmetic and personal care industries for i...

Compound Q&A

What precautions should be taken when handling Polyquaternium 7 (CAS: 26590-05-6)?

When handling Polyquaternium 7 (CAS: 26590-05-6), it is essential to use personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...