Compound Q&A

What industries use Polyquaternium 7 (CAS: 26590-05-6)?

Answer

Polyquaternium 7
Polyquaternium 7 (CAS: 26590-05-6) is widely used in the cosmetic and personal care industries for its excellent water solubility and conditioning properties. It is also employed in the textile industry for softening and anti-static treatments. Additionally, it finds applications in pharmaceuticals for its antimicrobial properties and in polymer science for improving the mechanical properties of polymers.

About

CAS No 26590-05-6
English Name Polyquaternium 7
Molecular Formula C11H21ClN2O
Molecular Weight 232.75 g/mol
SMILES C[N+](C)(CC=C)CC=C.C=CC(=O)N.[Cl-]
InChIKey XFOSBZOUUACCCN-UHFFFAOYSA-M
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Polyquaternium 7 (CAS: 26590-05-6)?

Polyquaternium 7 (CAS: 26590-05-6) is a water-soluble polymer characterized by its crystalline form....

Compound Q&A

How is Polyquaternium 7 (CAS: 26590-05-6) typically synthesized?

Polyquaternium 7 (CAS: 26590-05-6) is synthesized through the polymerization of 2-vinylpyridine with...

Compound Q&A

What precautions should be taken when handling Polyquaternium 7 (CAS: 26590-05-6)?

When handling Polyquaternium 7 (CAS: 26590-05-6), it is essential to use personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...