Compound Q&A

What are the physical and chemical properties of Polyquaternium 7 (CAS: 26590-05-6)?

Answer

Polyquaternium 7
Polyquaternium 7 (CAS: 26590-05-6) is a water-soluble polymer characterized by its crystalline form. It has a broad molecular weight range and exhibits good solubility in water. Chemically, it displays quaternary ammonium functionality, which makes it highly reactive towards nucleophiles. It is stable under normal conditions but can degrade under strong acidic or basic conditions.

About

CAS No 26590-05-6
English Name Polyquaternium 7
Molecular Formula C11H21ClN2O
Molecular Weight 232.75 g/mol
SMILES C[N+](C)(CC=C)CC=C.C=CC(=O)N.[Cl-]
InChIKey XFOSBZOUUACCCN-UHFFFAOYSA-M
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is Polyquaternium 7 (CAS: 26590-05-6) typically synthesized?

Polyquaternium 7 (CAS: 26590-05-6) is synthesized through the polymerization of 2-vinylpyridine with...

Compound Q&A

What industries use Polyquaternium 7 (CAS: 26590-05-6)?

Polyquaternium 7 (CAS: 26590-05-6) is widely used in the cosmetic and personal care industries for i...

Compound Q&A

What precautions should be taken when handling Polyquaternium 7 (CAS: 26590-05-6)?

When handling Polyquaternium 7 (CAS: 26590-05-6), it is essential to use personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...