Compound Q&A

What precautions should be taken when handling 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid (CAS: 862574-88-7)?

Answer

1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid
When handling 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be handled in a well-ventilated area or a fume hood to minimize exposure. Spills should be cleaned up according to standard laboratory procedures, and the material safety data sheet (MSDS) should be consulted for specific disposal instructions. This compound is stable under normal conditions but should be stored away from heat sources and strong bases.

About

English Name 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid
Molecular Formula C11H8F2O4
Molecular Weight 242.18 g/mol
SMILES OC(=O)C1(CC1)c2ccc3OC(F)(F)Oc3c2
InChIKey IELWGOUPQRHXLS-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid (CAS: 862574-88-7)?

1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid is a crystalline compound with a mo...

Compound Q&A

How is 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid (CAS: 862574-88-7) typically synthesized?

1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid is typically synthesized via a mult...

Compound Q&A

What industries use 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid (CAS: 862574-88-7)?

1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid is used in the pharmaceutical indus...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...