Compound Q&A

What industries use 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid (CAS: 862574-88-7)?

Answer

1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid
1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid is used in the pharmaceutical industry for the synthesis of pharmaceutical intermediates. It also finds applications in the polymer industry as a monomer and in the development of advanced materials. This compound is also utilized in the field of chemical sensors due to its specific reactivity and stability under various conditions.

About

English Name 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid
Molecular Formula C11H8F2O4
Molecular Weight 242.18 g/mol
SMILES OC(=O)C1(CC1)c2ccc3OC(F)(F)Oc3c2
InChIKey IELWGOUPQRHXLS-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid (CAS: 862574-88-7)?

1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid is a crystalline compound with a mo...

Compound Q&A

How is 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid (CAS: 862574-88-7) typically synthesized?

1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid is typically synthesized via a mult...

Compound Q&A

What precautions should be taken when handling 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid (CAS: 862574-88-7)?

When handling 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid, it is essential to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...