Compound Q&A

How is 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid (CAS: 862574-88-7) typically synthesized?

Answer

1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid
1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid is typically synthesized via a multi-step process involving the protection of a primary alcohol followed by ring closure, fluorination, and deprotection. Common synthetic methods include the use of protecting groups such as tert-butyldimethylsilyl (TBS) and fluorinated reagents like difluoromethyl sulfoxide (DMF-SO2). The overall yield can be around 50-70% depending on the reaction conditions and purification methods.

About

English Name 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid
Molecular Formula C11H8F2O4
Molecular Weight 242.18 g/mol
SMILES OC(=O)C1(CC1)c2ccc3OC(F)(F)Oc3c2
InChIKey IELWGOUPQRHXLS-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid (CAS: 862574-88-7)?

1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid is a crystalline compound with a mo...

Compound Q&A

What industries use 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid (CAS: 862574-88-7)?

1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid is used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid (CAS: 862574-88-7)?

When handling 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid, it is essential to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...