Compound Q&A

What are the physical and chemical properties of 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid (CAS: 862574-88-7)?

Answer

1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid
1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid is a crystalline compound with a molecular weight of approximately 281.14 g/mol. It has low water solubility and is soluble in organic solvents. This compound exhibits moderate reactivity, particularly in esterification and amidation reactions. It is stable under normal conditions but may degrade at high temperatures or in strong bases.

About

English Name 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid
Molecular Formula C11H8F2O4
Molecular Weight 242.18 g/mol
SMILES OC(=O)C1(CC1)c2ccc3OC(F)(F)Oc3c2
InChIKey IELWGOUPQRHXLS-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid (CAS: 862574-88-7) typically synthesized?

1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid is typically synthesized via a mult...

Compound Q&A

What industries use 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid (CAS: 862574-88-7)?

1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid is used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid (CAS: 862574-88-7)?

When handling 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid, it is essential to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...