Compound Q&A

What industries use 1-(2-Methyl-5-nitrophenyl)guanidine nitrate (CAS: 152460-08-7)?

Answer

1-(2-Methyl-5-nitrophenyl)guanidine nitrate (1:1)
1-(2-Methyl-5-nitrophenyl)guanidine nitrate (1:1) finds applications in the pharmaceutical industry for the synthesis of certain bioactive compounds. It is also used in the polymer industry as a stabilizer and in the development of sensors for detecting specific chemical species. Additionally, it has potential uses in the semiconductor industry for surface modification and passivation of materials.

About

English Name 1-(2-Methyl-5-nitrophenyl)guanidine nitrate (1:1)
Molecular Formula C8H11N5O5
Molecular Weight 257.2 g/mol
SMILES CC1=C(C=C(C=C1)[N+](=O)[O-])N=C(N)N.[N+](=O)(O)[O-]
InChIKey IINMQQJNRFDBMV-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(2-Methyl-5-nitrophenyl)guanidine nitrate (CAS: 152460-08-7)?

1-(2-Methyl-5-nitrophenyl)guanidine nitrate (1:1) is a crystalline compound with a molecular weight ...

Compound Q&A

How is 1-(2-Methyl-5-nitrophenyl)guanidine nitrate (CAS: 152460-08-7) typically synthesized?

1-(2-Methyl-5-nitrophenyl)guanidine nitrate (1:1) is typically synthesized by the nitration of 2-met...

Compound Q&A

What precautions should be taken when handling 1-(2-Methyl-5-nitrophenyl)guanidine nitrate (CAS: 152460-08-7)?

When handling 1-(2-Methyl-5-nitrophenyl)guanidine nitrate (1:1), it is crucial to use personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...