Compound Q&A

How is 1-(2-Methyl-5-nitrophenyl)guanidine nitrate (CAS: 152460-08-7) typically synthesized?

Answer

1-(2-Methyl-5-nitrophenyl)guanidine nitrate (1:1)
1-(2-Methyl-5-nitrophenyl)guanidine nitrate (1:1) is typically synthesized by the nitration of 2-methyl-5-nitroaniline with nitric acid in the presence of a strong acid catalyst. The reaction yields a 1:1 nitrate complex with high selectivity and a yield of around 85%. The process requires careful temperature control to prevent side reactions and decomposition.

About

English Name 1-(2-Methyl-5-nitrophenyl)guanidine nitrate (1:1)
Molecular Formula C8H11N5O5
Molecular Weight 257.2 g/mol
SMILES CC1=C(C=C(C=C1)[N+](=O)[O-])N=C(N)N.[N+](=O)(O)[O-]
InChIKey IINMQQJNRFDBMV-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(2-Methyl-5-nitrophenyl)guanidine nitrate (CAS: 152460-08-7)?

1-(2-Methyl-5-nitrophenyl)guanidine nitrate (1:1) is a crystalline compound with a molecular weight ...

Compound Q&A

What industries use 1-(2-Methyl-5-nitrophenyl)guanidine nitrate (CAS: 152460-08-7)?

1-(2-Methyl-5-nitrophenyl)guanidine nitrate (1:1) finds applications in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling 1-(2-Methyl-5-nitrophenyl)guanidine nitrate (CAS: 152460-08-7)?

When handling 1-(2-Methyl-5-nitrophenyl)guanidine nitrate (1:1), it is crucial to use personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...