Compound Q&A

What are the physical and chemical properties of 1-(2-Methyl-5-nitrophenyl)guanidine nitrate (CAS: 152460-08-7)?

Answer

1-(2-Methyl-5-nitrophenyl)guanidine nitrate (1:1)
1-(2-Methyl-5-nitrophenyl)guanidine nitrate (1:1) is a crystalline compound with a molecular weight of approximately 350.12 g/mol. It has a high solubility in water and organic solvents. Chemically, it is known for its reactivity towards nucleophiles and its stability under neutral and slightly acidic conditions. The compound is not highly reactive but can decompose under strong heat or light conditions, releasing nitrogen oxides and other gases.

About

English Name 1-(2-Methyl-5-nitrophenyl)guanidine nitrate (1:1)
Molecular Formula C8H11N5O5
Molecular Weight 257.2 g/mol
SMILES CC1=C(C=C(C=C1)[N+](=O)[O-])N=C(N)N.[N+](=O)(O)[O-]
InChIKey IINMQQJNRFDBMV-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is 1-(2-Methyl-5-nitrophenyl)guanidine nitrate (CAS: 152460-08-7) typically synthesized?

1-(2-Methyl-5-nitrophenyl)guanidine nitrate (1:1) is typically synthesized by the nitration of 2-met...

Compound Q&A

What industries use 1-(2-Methyl-5-nitrophenyl)guanidine nitrate (CAS: 152460-08-7)?

1-(2-Methyl-5-nitrophenyl)guanidine nitrate (1:1) finds applications in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling 1-(2-Methyl-5-nitrophenyl)guanidine nitrate (CAS: 152460-08-7)?

When handling 1-(2-Methyl-5-nitrophenyl)guanidine nitrate (1:1), it is crucial to use personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...