Compound Q&A

What industries use 2-Methyl-2-propanyl (3-aminophenyl)carbamate (CAS: 68621-88-5)?

Answer

2-Methyl-2-propanyl (3-aminophenyl)carbamate
2-Methyl-2-propanyl (3-aminophenyl)carbamate finds application in various industries, including pharmaceuticals, where it is used as an intermediate in the synthesis of certain drugs. It is also utilized in the production of polymers and as a component in sensors due to its chemical stability and reactivity. Additionally, it has applications in the semiconductor industry for its role in specific chemical processes.

About

CAS No 68621-88-5
English Name 2-Methyl-2-propanyl (3-aminophenyl)carbamate
Molecular Formula C11H16N2O2
Molecular Weight 208.26 g/mol
SMILES CC(C)(C)OC(=O)NC1=CC=CC(=C1)N
InChIKey IEUIEMIRUXSXCL-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (3-aminophenyl)carbamate (CAS: 68621-88-5)?

2-Methyl-2-propanyl (3-aminophenyl)carbamate is a white crystalline solid with a molecular weight of...

Compound Q&A

How is 2-Methyl-2-propanyl (3-aminophenyl)carbamate (CAS: 68621-88-5) typically synthesized?

2-Methyl-2-propanyl (3-aminophenyl)carbamate is commonly synthesized via a multi-step process involv...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (3-aminophenyl)carbamate (CAS: 68621-88-5)?

When handling 2-Methyl-2-propanyl (3-aminophenyl)carbamate, it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...