Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (3-aminophenyl)carbamate (CAS: 68621-88-5)?

Answer

2-Methyl-2-propanyl (3-aminophenyl)carbamate
2-Methyl-2-propanyl (3-aminophenyl)carbamate is a white crystalline solid with a molecular weight of approximately 208.26 g/mol. It is slightly soluble in water and has good solubility in organic solvents. This compound is known for its moderate reactivity, particularly in nucleophilic substitution reactions. It exhibits good stability under normal storage conditions but requires protection from moisture and air to prevent degradation.

About

CAS No 68621-88-5
English Name 2-Methyl-2-propanyl (3-aminophenyl)carbamate
Molecular Formula C11H16N2O2
Molecular Weight 208.26 g/mol
SMILES CC(C)(C)OC(=O)NC1=CC=CC(=C1)N
InChIKey IEUIEMIRUXSXCL-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl (3-aminophenyl)carbamate (CAS: 68621-88-5) typically synthesized?

2-Methyl-2-propanyl (3-aminophenyl)carbamate is commonly synthesized via a multi-step process involv...

Compound Q&A

What industries use 2-Methyl-2-propanyl (3-aminophenyl)carbamate (CAS: 68621-88-5)?

2-Methyl-2-propanyl (3-aminophenyl)carbamate finds application in various industries, including phar...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (3-aminophenyl)carbamate (CAS: 68621-88-5)?

When handling 2-Methyl-2-propanyl (3-aminophenyl)carbamate, it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...